About 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine
3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine (PubChem CID 164656493) has the molecular formula C10H16BrF2NS
and a molecular weight of 300.21 g/mol. Its IUPAC name is 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine.
Molecular Properties
| Compound Name | 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine |
| PubChem CID | 164656493 |
| Molecular Formula | C10H16BrF2NS |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine |
| SMILES | FC1(F)CCN(C2CCSC2)CC1CBr |
| InChI | InChI=1S/C10H16BrF2NS/c11-5-8-6-14(3-2-10(8,12)13)9-1-4-15-7-9/h8-9H,1-7H2 |
| InChIKey | QZDPUFNWNGZUIF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine?
The IUPAC name of 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine (CID 164656493) is 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine.
What is the SMILES notation for 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine?
The canonical SMILES for 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine is FC1(F)CCN(C2CCSC2)CC1CBr.
What is the InChIKey of 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine?
The InChIKey is QZDPUFNWNGZUIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16BrF2NS/c11-5-8-6-14(3-2-10(8,12)13)9-1-4-15-7-9/h8-9H,1-7H2.
What are the key properties of 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine?
3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine has a molecular weight of 300.21 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-4,4-difluoro-1-(thiolan-3-yl)piperidine is sourced from PubChem (CID 164656493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).