About [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid
[2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid (PubChem CID 164656536) has the molecular formula C9H13BN2O3S
and a molecular weight of 240.09 g/mol. Its IUPAC name is [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid.
Molecular Properties
| Compound Name | [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid |
| PubChem CID | 164656536 |
| Molecular Formula | C9H13BN2O3S |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid |
| SMILES | CCC1CC1C(=O)Nc1ncc(B(O)O)s1 |
| InChI | InChI=1S/C9H13BN2O3S/c1-2-5-3-6(5)8(13)12-9-11-4-7(16-9)10(14)15/h4-6,14-15H,2-3H2,1H3,(H,11,12,13) |
| InChIKey | KDXFUTJESMRJDI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid?
The IUPAC name of [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid (CID 164656536) is [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid.
What is the SMILES notation for [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid?
The canonical SMILES for [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid is CCC1CC1C(=O)Nc1ncc(B(O)O)s1.
What is the InChIKey of [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid?
The InChIKey is KDXFUTJESMRJDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BN2O3S/c1-2-5-3-6(5)8(13)12-9-11-4-7(16-9)10(14)15/h4-6,14-15H,2-3H2,1H3,(H,11,12,13).
What are the key properties of [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid?
[2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid has a molecular weight of 240.09 g/mol, XLogP of -0.19, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-ethylcyclopropanecarbonyl)amino]-1,3-thiazol-5-yl]boronic acid is sourced from PubChem (CID 164656536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).