About N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine
N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine (PubChem CID 164656653) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine |
| PubChem CID | 164656653 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine |
| SMILES | CC1OCC(NCC2CC2)C1C |
| InChI | InChI=1S/C10H19NO/c1-7-8(2)12-6-10(7)11-5-9-3-4-9/h7-11H,3-6H2,1-2H3 |
| InChIKey | IFBYHTHBMRJHQN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine?
The IUPAC name of N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine (CID 164656653) is N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine.
What is the SMILES notation for N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine?
The canonical SMILES for N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine is CC1OCC(NCC2CC2)C1C.
What is the InChIKey of N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine?
The InChIKey is IFBYHTHBMRJHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-7-8(2)12-6-10(7)11-5-9-3-4-9/h7-11H,3-6H2,1-2H3.
What are the key properties of N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine?
N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine has a molecular weight of 169.27 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-4,5-dimethyloxolan-3-amine is sourced from PubChem (CID 164656653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).