C12H13NO — CID 164657026
N-[(4-methylphenyl)methyl]but-3-ynamide (PubChem CID 164657026) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]but-3-ynamide.
| Compound Name | N-[(4-methylphenyl)methyl]but-3-ynamide |
|---|---|
| PubChem CID | 164657026 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | N-[(4-methylphenyl)methyl]but-3-ynamide |
| SMILES | C#CCC(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C12H13NO/c1-3-4-12(14)13-9-11-7-5-10(2)6-8-11/h1,5-8H,4,9H2,2H3,(H,13,14) |
| InChIKey | WHQHDBXECRAIFV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|