About 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine
3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine (PubChem CID 164657187) has the molecular formula C9H9FN4S
and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine |
| PubChem CID | 164657187 |
| Molecular Formula | C9H9FN4S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine |
| SMILES | Cc1ncsc1CNc1nccnc1F |
| InChI | InChI=1S/C9H9FN4S/c1-6-7(15-5-14-6)4-13-9-8(10)11-2-3-12-9/h2-3,5H,4H2,1H3,(H,12,13) |
| InChIKey | KENGGSWFFVWXPB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine?
The IUPAC name of 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine (CID 164657187) is 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine.
What is the SMILES notation for 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine?
The canonical SMILES for 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine is Cc1ncsc1CNc1nccnc1F.
What is the InChIKey of 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine?
The InChIKey is KENGGSWFFVWXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN4S/c1-6-7(15-5-14-6)4-13-9-8(10)11-2-3-12-9/h2-3,5H,4H2,1H3,(H,12,13).
What are the key properties of 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine?
3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine has a molecular weight of 224.26 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrazin-2-amine is sourced from PubChem (CID 164657187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).