C5H10N4OS — CID 164657237
N-(ethylsulfonimidoyl)-1H-imidazol-2-amine (PubChem CID 164657237) has the molecular formula C5H10N4OS and a molecular weight of 174.23 g/mol. Its IUPAC name is N-(ethylsulfonimidoyl)-1H-imidazol-2-amine.
| Compound Name | N-(ethylsulfonimidoyl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 164657237 |
| Molecular Formula | C5H10N4OS |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | N-(ethylsulfonimidoyl)-1H-imidazol-2-amine |
| SMILES | [H]N=S(=O)(CC)Nc1ncc[nH]1 |
| InChI | InChI=1S/C5H10N4OS/c1-2-11(6,10)9-5-7-3-4-8-5/h3-4H,2H2,1H3,(H3,6,7,8,9,10) |
| InChIKey | WKLBNEAIBMOCLK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |