C8H16F2N4 — CID 164657363
N-amino-N'-ethyl-4,4-difluoropiperidine-1-carboximidamide (PubChem CID 164657363) has the molecular formula C8H16F2N4 and a molecular weight of 206.24 g/mol. Its IUPAC name is N-amino-N'-ethyl-4,4-difluoropiperidine-1-carboximidamide.
| Compound Name | N-amino-N'-ethyl-4,4-difluoropiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 164657363 |
| Molecular Formula | C8H16F2N4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | N-amino-N'-ethyl-4,4-difluoropiperidine-1-carboximidamide |
| SMILES | CC/N=C(\NN)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H16F2N4/c1-2-12-7(13-11)14-5-3-8(9,10)4-6-14/h2-6,11H2,1H3,(H,12,13) |
| InChIKey | RRLPXTYNJPPWLT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|