C8H15F2N3O — CID 164657436
3-(3,3-difluoropiperidin-1-yl)propanehydrazide (PubChem CID 164657436) has the molecular formula C8H15F2N3O and a molecular weight of 207.22 g/mol. Its IUPAC name is 3-(3,3-difluoropiperidin-1-yl)propanehydrazide.
| Compound Name | 3-(3,3-difluoropiperidin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 164657436 |
| Molecular Formula | C8H15F2N3O |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 3-(3,3-difluoropiperidin-1-yl)propanehydrazide |
| SMILES | NNC(=O)CCN1CCCC(F)(F)C1 |
| InChI | InChI=1S/C8H15F2N3O/c9-8(10)3-1-4-13(6-8)5-2-7(14)12-11/h1-6,11H2,(H,12,14) |
| InChIKey | IKOBTVLOPCDHIB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|