C9H17N5 — CID 164657538
N-[(1-aminocyclopentyl)methyl]-3-methyltriazol-4-amine (PubChem CID 164657538) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is N-[(1-aminocyclopentyl)methyl]-3-methyltriazol-4-amine.
| Compound Name | N-[(1-aminocyclopentyl)methyl]-3-methyltriazol-4-amine |
|---|---|
| PubChem CID | 164657538 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | N-[(1-aminocyclopentyl)methyl]-3-methyltriazol-4-amine |
| SMILES | Cn1nncc1NCC1(N)CCCC1 |
| InChI | InChI=1S/C9H17N5/c1-14-8(6-12-13-14)11-7-9(10)4-2-3-5-9/h6,11H,2-5,7,10H2,1H3 |
| InChIKey | FIGANIPZBHUYRZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |