C13H24BrN — CID 164657785
4-bromo-1-(2-cyclobutylethyl)-3,5-dimethylpiperidine (PubChem CID 164657785) has the molecular formula C13H24BrN and a molecular weight of 274.25 g/mol. Its IUPAC name is 4-bromo-1-(2-cyclobutylethyl)-3,5-dimethylpiperidine.
| Compound Name | 4-bromo-1-(2-cyclobutylethyl)-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 164657785 |
| Molecular Formula | C13H24BrN |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-bromo-1-(2-cyclobutylethyl)-3,5-dimethylpiperidine |
| SMILES | CC1CN(CCC2CCC2)CC(C)C1Br |
| InChI | InChI=1S/C13H24BrN/c1-10-8-15(9-11(2)13(10)14)7-6-12-4-3-5-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | CPBCDYCCFYHNIC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|