[1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid

C10H9BClFN2O2 — CID 164658903

IUPAC[1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid
SMILESOB(O)c1cnn(Cc2cc(Cl)ccc2F)c1
InChIInChI=1S/C10H9BClFN2O2/c12-9-1-2-10(13)7(3-9)5-15-6-8(4-14-15)11(16)17/h1-4,6,16-17H,5H2
InChIKeyTZMVHDHELPFDBN-UHFFFAOYSA-N
MW254.46 g/mol
LogP0.40
Rot. Bonds3

About [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid

[1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid (PubChem CID 164658903) has the molecular formula C10H9BClFN2O2 and a molecular weight of 254.46 g/mol. Its IUPAC name is [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid.

Molecular Properties

Compound Name[1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid
PubChem CID164658903
Molecular FormulaC10H9BClFN2O2
Molecular Weight254.46 g/mol
Exact Mass254.04
IUPAC Name[1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid
SMILESOB(O)c1cnn(Cc2cc(Cl)ccc2F)c1
InChIInChI=1S/C10H9BClFN2O2/c12-9-1-2-10(13)7(3-9)5-15-6-8(4-14-15)11(16)17/h1-4,6,16-17H,5H2
InChIKeyTZMVHDHELPFDBN-UHFFFAOYSA-N
XLogP0.40
TPSA58.28 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.46
LogP ≤ 50.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid?
The IUPAC name of [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid (CID 164658903) is [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid.
What is the SMILES notation for [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid?
The canonical SMILES for [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid is OB(O)c1cnn(Cc2cc(Cl)ccc2F)c1.
What is the InChIKey of [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid?
The InChIKey is TZMVHDHELPFDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BClFN2O2/c12-9-1-2-10(13)7(3-9)5-15-6-8(4-14-15)11(16)17/h1-4,6,16-17H,5H2.
What are the key properties of [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid?
[1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid has a molecular weight of 254.46 g/mol, XLogP of 0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-chloro-2-fluorophenyl)methyl]pyrazol-4-yl]boronic acid is sourced from PubChem (CID 164658903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).