C6H3ClF5NO — CID 164658928
5-(chloromethyl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazole (PubChem CID 164658928) has the molecular formula C6H3ClF5NO and a molecular weight of 235.54 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazole.
| Compound Name | 5-(chloromethyl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 164658928 |
| Molecular Formula | C6H3ClF5NO |
| Molecular Weight | 235.54 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 5-(chloromethyl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazole |
| SMILES | FC(F)(F)C(F)(F)c1ncc(CCl)o1 |
| InChI | InChI=1S/C6H3ClF5NO/c7-1-3-2-13-4(14-3)5(8,9)6(10,11)12/h2H,1H2 |
| InChIKey | NDAHXCUWDSQJJI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|