C13H24O2 — CID 164659254
1-(methoxymethyl)-3,3,5,5-tetramethylcyclohexane-1-carbaldehyde (PubChem CID 164659254) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 1-(methoxymethyl)-3,3,5,5-tetramethylcyclohexane-1-carbaldehyde.
| Compound Name | 1-(methoxymethyl)-3,3,5,5-tetramethylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 164659254 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 1-(methoxymethyl)-3,3,5,5-tetramethylcyclohexane-1-carbaldehyde |
| SMILES | COCC1(C=O)CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H24O2/c1-11(2)6-12(3,4)8-13(7-11,9-14)10-15-5/h9H,6-8,10H2,1-5H3 |
| InChIKey | UZFUBIOGJOWTQM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|