C10H19FN2S — CID 164659405
4-fluoro-1-(4-methylsulfanylpyrrolidin-3-yl)piperidine (PubChem CID 164659405) has the molecular formula C10H19FN2S and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-fluoro-1-(4-methylsulfanylpyrrolidin-3-yl)piperidine.
| Compound Name | 4-fluoro-1-(4-methylsulfanylpyrrolidin-3-yl)piperidine |
|---|---|
| PubChem CID | 164659405 |
| Molecular Formula | C10H19FN2S |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-fluoro-1-(4-methylsulfanylpyrrolidin-3-yl)piperidine |
| SMILES | CSC1CNCC1N1CCC(F)CC1 |
| InChI | InChI=1S/C10H19FN2S/c1-14-10-7-12-6-9(10)13-4-2-8(11)3-5-13/h8-10,12H,2-7H2,1H3 |
| InChIKey | FYFLIWHJTKQSBL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |