About (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide
(E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide (PubChem CID 164659860) has the molecular formula C7H14N2O2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide.
Molecular Properties
| Compound Name | (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide |
| PubChem CID | 164659860 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide |
| SMILES | C/C(=C\CN)C(=O)N=S(C)(C)=O |
| InChI | InChI=1S/C7H14N2O2S/c1-6(4-5-8)7(10)9-12(2,3)11/h4H,5,8H2,1-3H3/b6-4+ |
| InChIKey | IKDPSWWPVDFUQD-GQCTYLIASA-N |
| XLogP | 0.15 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide?
The IUPAC name of (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide (CID 164659860) is (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide.
What is the SMILES notation for (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide?
The canonical SMILES for (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide is C/C(=C\CN)C(=O)N=S(C)(C)=O.
What is the InChIKey of (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide?
The InChIKey is IKDPSWWPVDFUQD-GQCTYLIASA-N. The full InChI is InChI=1S/C7H14N2O2S/c1-6(4-5-8)7(10)9-12(2,3)11/h4H,5,8H2,1-3H3/b6-4+.
What are the key properties of (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide?
(E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide has a molecular weight of 190.27 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-amino-N-[dimethyl(oxo)-λ6-sulfanylidene]-2-methylbut-2-enamide is sourced from PubChem (CID 164659860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).