About [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride
[1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride (PubChem CID 164660705) has the molecular formula C6H3ClN4O
and a molecular weight of 182.57 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride.
Molecular Properties
| Compound Name | [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride |
| PubChem CID | 164660705 |
| Molecular Formula | C6H3ClN4O |
| Molecular Weight | 182.57 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride |
| SMILES | O=C(Cl)c1cn2cnnc2cn1 |
| InChI | InChI=1S/C6H3ClN4O/c7-6(12)4-2-11-3-9-10-5(11)1-8-4/h1-3H |
| InChIKey | AEVHEPCPHSHABA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.57 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride?
The IUPAC name of [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride (CID 164660705) is [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride.
What is the SMILES notation for [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride?
The canonical SMILES for [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride is O=C(Cl)c1cn2cnnc2cn1.
What is the InChIKey of [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride?
The InChIKey is AEVHEPCPHSHABA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN4O/c7-6(12)4-2-11-3-9-10-5(11)1-8-4/h1-3H.
What are the key properties of [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride?
[1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride has a molecular weight of 182.57 g/mol, XLogP of 0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[4,3-a]pyrazine-6-carbonyl chloride is sourced from PubChem (CID 164660705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).