C4H5F3N4O2S — CID 164660969
2,2,2-trifluoro-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide (PubChem CID 164660969) has the molecular formula C4H5F3N4O2S and a molecular weight of 230.17 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 164660969 |
| Molecular Formula | C4H5F3N4O2S |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 2,2,2-trifluoro-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide |
| SMILES | O=S(=O)(CC(F)(F)F)Nc1ncn[nH]1 |
| InChI | InChI=1S/C4H5F3N4O2S/c5-4(6,7)1-14(12,13)11-3-8-2-9-10-3/h2H,1H2,(H2,8,9,10,11) |
| InChIKey | HLUWSVAYXLEEST-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |