C9H18N4O — CID 164661243
N-[2-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)ethyl]acetamide (PubChem CID 164661243) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is N-[2-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)ethyl]acetamide.
| Compound Name | N-[2-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 164661243 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | N-[2-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)ethyl]acetamide |
| SMILES | CC(=O)NCCNC1=NCCCCN1 |
| InChI | InChI=1S/C9H18N4O/c1-8(14)10-6-7-13-9-11-4-2-3-5-12-9/h2-7H2,1H3,(H,10,14)(H2,11,12,13) |
| InChIKey | VKWPOSAYVCKOTF-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|