C13H23FO — CID 164661464
1-(2-fluoroethyl)-3,3,5,5-tetramethylcyclohexane-1-carbaldehyde (PubChem CID 164661464) has the molecular formula C13H23FO and a molecular weight of 214.32 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3,3,5,5-tetramethylcyclohexane-1-carbaldehyde.
| Compound Name | 1-(2-fluoroethyl)-3,3,5,5-tetramethylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 164661464 |
| Molecular Formula | C13H23FO |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-(2-fluoroethyl)-3,3,5,5-tetramethylcyclohexane-1-carbaldehyde |
| SMILES | CC1(C)CC(C)(C)CC(C=O)(CCF)C1 |
| InChI | InChI=1S/C13H23FO/c1-11(2)7-12(3,4)9-13(8-11,10-15)5-6-14/h10H,5-9H2,1-4H3 |
| InChIKey | GMCMINJTZQZHRO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|