About 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one
5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one (PubChem CID 164661581) has the molecular formula C8H7IN4OS
and a molecular weight of 334.14 g/mol. Its IUPAC name is 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one |
| PubChem CID | 164661581 |
| Molecular Formula | C8H7IN4OS |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one |
| SMILES | Cc1nnc(Cn2cncc(I)c2=O)s1 |
| InChI | InChI=1S/C8H7IN4OS/c1-5-11-12-7(15-5)3-13-4-10-2-6(9)8(13)14/h2,4H,3H2,1H3 |
| InChIKey | MFPNSEQHAKWLFO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one?
The IUPAC name of 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one (CID 164661581) is 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one.
What is the SMILES notation for 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one?
The canonical SMILES for 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one is Cc1nnc(Cn2cncc(I)c2=O)s1.
What is the InChIKey of 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one?
The InChIKey is MFPNSEQHAKWLFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IN4OS/c1-5-11-12-7(15-5)3-13-4-10-2-6(9)8(13)14/h2,4H,3H2,1H3.
What are the key properties of 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one?
5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one has a molecular weight of 334.14 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-one is sourced from PubChem (CID 164661581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).