About 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole
4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole (PubChem CID 164661711) has the molecular formula C7H13N3O2S2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole |
| PubChem CID | 164661711 |
| Molecular Formula | C7H13N3O2S2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole |
| SMILES | Cc1nc(CN(C)S(N)(=O)=O)sc1C |
| InChI | InChI=1S/C7H13N3O2S2/c1-5-6(2)13-7(9-5)4-10(3)14(8,11)12/h4H2,1-3H3,(H2,8,11,12) |
| InChIKey | OHIWKPIMTXUKBQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole?
The IUPAC name of 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole (CID 164661711) is 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole.
What is the SMILES notation for 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole?
The canonical SMILES for 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole is Cc1nc(CN(C)S(N)(=O)=O)sc1C.
What is the InChIKey of 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole?
The InChIKey is OHIWKPIMTXUKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2S2/c1-5-6(2)13-7(9-5)4-10(3)14(8,11)12/h4H2,1-3H3,(H2,8,11,12).
What are the key properties of 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole?
4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole has a molecular weight of 235.33 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-[[methyl(sulfamoyl)amino]methyl]-1,3-thiazole is sourced from PubChem (CID 164661711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).