About 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione
4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione (PubChem CID 164662166) has the molecular formula C8H13NO5
and a molecular weight of 203.19 g/mol. Its IUPAC name is 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione.
Molecular Properties
| Compound Name | 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione |
| PubChem CID | 164662166 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione |
| SMILES | CC(C(O)CO)N1C(=O)COCC1=O |
| InChI | InChI=1S/C8H13NO5/c1-5(6(11)2-10)9-7(12)3-14-4-8(9)13/h5-6,10-11H,2-4H2,1H3 |
| InChIKey | DQFHLICIFYVOFI-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione?
The IUPAC name of 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione (CID 164662166) is 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione.
What is the SMILES notation for 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione?
The canonical SMILES for 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione is CC(C(O)CO)N1C(=O)COCC1=O.
What is the InChIKey of 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione?
The InChIKey is DQFHLICIFYVOFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO5/c1-5(6(11)2-10)9-7(12)3-14-4-8(9)13/h5-6,10-11H,2-4H2,1H3.
What are the key properties of 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione?
4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione has a molecular weight of 203.19 g/mol, XLogP of -1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydroxybutan-2-yl)morpholine-3,5-dione is sourced from PubChem (CID 164662166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).