About 3-bromo-5,6,7,8-tetrahydrocinnoline
3-bromo-5,6,7,8-tetrahydrocinnoline (PubChem CID 164662735) has the molecular formula C8H9BrN2
and a molecular weight of 213.08 g/mol. Its IUPAC name is 3-bromo-5,6,7,8-tetrahydrocinnoline.
Molecular Properties
| Compound Name | 3-bromo-5,6,7,8-tetrahydrocinnoline |
| PubChem CID | 164662735 |
| Molecular Formula | C8H9BrN2 |
| Molecular Weight | 213.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 3-bromo-5,6,7,8-tetrahydrocinnoline |
| SMILES | Brc1cc2c(nn1)CCCC2 |
| InChI | InChI=1S/C8H9BrN2/c9-8-5-6-3-1-2-4-7(6)10-11-8/h5H,1-4H2 |
| InChIKey | RCMMBUOPGNASKY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.08 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5,6,7,8-tetrahydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5,6,7,8-tetrahydrocinnoline?
The IUPAC name of 3-bromo-5,6,7,8-tetrahydrocinnoline (CID 164662735) is 3-bromo-5,6,7,8-tetrahydrocinnoline.
What is the SMILES notation for 3-bromo-5,6,7,8-tetrahydrocinnoline?
The canonical SMILES for 3-bromo-5,6,7,8-tetrahydrocinnoline is Brc1cc2c(nn1)CCCC2.
What is the InChIKey of 3-bromo-5,6,7,8-tetrahydrocinnoline?
The InChIKey is RCMMBUOPGNASKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2/c9-8-5-6-3-1-2-4-7(6)10-11-8/h5H,1-4H2.
What are the key properties of 3-bromo-5,6,7,8-tetrahydrocinnoline?
3-bromo-5,6,7,8-tetrahydrocinnoline has a molecular weight of 213.08 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5,6,7,8-tetrahydrocinnoline is sourced from PubChem (CID 164662735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).