C18H19Cl2N3O4S — CID 164663534
2-(4-amino-N-(4-hydroxy-1,1-dioxothiolan-3-yl)anilino)-N-(3,5-dichlorophenyl)acetamide (PubChem CID 164663534) has the molecular formula C18H19Cl2N3O4S and a molecular weight of 444.34 g/mol. Its IUPAC name is 2-(4-amino-N-(4-hydroxy-1,1-dioxothiolan-3-yl)anilino)-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-(4-amino-N-(4-hydroxy-1,1-dioxothiolan-3-yl)anilino)-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 164663534 |
| Molecular Formula | C18H19Cl2N3O4S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 2-(4-amino-N-(4-hydroxy-1,1-dioxothiolan-3-yl)anilino)-N-(3,5-dichlorophenyl)acetamide |
| SMILES | Nc1ccc(N(CC(=O)Nc2cc(Cl)cc(Cl)c2)C2CS(=O)(=O)CC2O)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O4S/c19-11-5-12(20)7-14(6-11)22-18(25)8-23(15-3-1-13(21)2-4-15)16-9-28(26,27)10-17(16)24/h1-7,16-17,24H,8-10,21H2,(H,22,25) |
| InChIKey | CMRHQYIIWOKFQP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|