About 3-(2-bromopropyl)oxane
3-(2-bromopropyl)oxane (PubChem CID 164664099) has the molecular formula C8H15BrO
and a molecular weight of 207.11 g/mol. Its IUPAC name is 3-(2-bromopropyl)oxane.
Molecular Properties
| Compound Name | 3-(2-bromopropyl)oxane |
| PubChem CID | 164664099 |
| Molecular Formula | C8H15BrO |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 3-(2-bromopropyl)oxane |
| SMILES | CC(Br)CC1CCCOC1 |
| InChI | InChI=1S/C8H15BrO/c1-7(9)5-8-3-2-4-10-6-8/h7-8H,2-6H2,1H3 |
| InChIKey | BQMLWOWFANGWOI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromopropyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromopropyl)oxane?
The IUPAC name of 3-(2-bromopropyl)oxane (CID 164664099) is 3-(2-bromopropyl)oxane.
What is the SMILES notation for 3-(2-bromopropyl)oxane?
The canonical SMILES for 3-(2-bromopropyl)oxane is CC(Br)CC1CCCOC1.
What is the InChIKey of 3-(2-bromopropyl)oxane?
The InChIKey is BQMLWOWFANGWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrO/c1-7(9)5-8-3-2-4-10-6-8/h7-8H,2-6H2,1H3.
What are the key properties of 3-(2-bromopropyl)oxane?
3-(2-bromopropyl)oxane has a molecular weight of 207.11 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromopropyl)oxane is sourced from PubChem (CID 164664099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).