C18H8F2N2O2 — CID 164664210
16,17-difluoro-5-hydroxy-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-19-one (PubChem CID 164664210) has the molecular formula C18H8F2N2O2 and a molecular weight of 322.27 g/mol. Its IUPAC name is 16,17-difluoro-5-hydroxy-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-19-one.
| Compound Name | 16,17-difluoro-5-hydroxy-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-19-one |
|---|---|
| PubChem CID | 164664210 |
| Molecular Formula | C18H8F2N2O2 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 16,17-difluoro-5-hydroxy-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-19-one |
| SMILES | O=c1c2c(F)c(F)ccc2c2nccc3c4cc(O)ccc4n1c32 |
| InChI | InChI=1S/C18H8F2N2O2/c19-12-3-2-10-14(15(12)20)18(24)22-13-4-1-8(23)7-11(13)9-5-6-21-16(10)17(9)22/h1-7,23H |
| InChIKey | BPCMYLSJTWKXMV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|