About N-butylacetamide;N-propylacetamide
N-butylacetamide;N-propylacetamide (PubChem CID 164664390) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is N-butylacetamide;N-propylacetamide.
Molecular Properties
| Compound Name | N-butylacetamide;N-propylacetamide |
| PubChem CID | 164664390 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-butylacetamide;N-propylacetamide |
| SMILES | CCCCNC(C)=O.CCCNC(C)=O |
| InChI | InChI=1S/C6H13NO.C5H11NO/c1-3-4-5-7-6(2)8;1-3-4-6-5(2)7/h3-5H2,1-2H3,(H,7,8);3-4H2,1-2H3,(H,6,7) |
| InChIKey | JCYPQDVENAXQML-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylacetamide;N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylacetamide;N-propylacetamide?
The IUPAC name of N-butylacetamide;N-propylacetamide (CID 164664390) is N-butylacetamide;N-propylacetamide.
What is the SMILES notation for N-butylacetamide;N-propylacetamide?
The canonical SMILES for N-butylacetamide;N-propylacetamide is CCCCNC(C)=O.CCCNC(C)=O.
What is the InChIKey of N-butylacetamide;N-propylacetamide?
The InChIKey is JCYPQDVENAXQML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C5H11NO/c1-3-4-5-7-6(2)8;1-3-4-6-5(2)7/h3-5H2,1-2H3,(H,7,8);3-4H2,1-2H3,(H,6,7).
What are the key properties of N-butylacetamide;N-propylacetamide?
N-butylacetamide;N-propylacetamide has a molecular weight of 216.32 g/mol, XLogP of 1.46, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylacetamide;N-propylacetamide is sourced from PubChem (CID 164664390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).