C18H26N4O3 — CID 164664429
2-[1-[[(3S,5S)-3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]methyl]piperidin-4-yl]acetic acid (PubChem CID 164664429) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[1-[[(3S,5S)-3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[[(3S,5S)-3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 164664429 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-[1-[[(3S,5S)-3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]methyl]piperidin-4-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc([C@@H]2C[C@@H](CN3CCC(CC(=O)O)CC3)ON2)cc1 |
| InChI | InChI=1S/C18H26N4O3/c19-18(20)14-3-1-13(2-4-14)16-10-15(25-21-16)11-22-7-5-12(6-8-22)9-17(23)24/h1-4,12,15-16,21H,5-11H2,(H3,19,20)(H,23,24)/t15-,16-/m0/s1 |
| InChIKey | ISWMAWCMFVMJCZ-HOTGVXAUSA-N |
| XLogP | 1.49 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|