About O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride
O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride (PubChem CID 164664890) has the molecular formula C8H10Cl2N2OS
and a molecular weight of 253.15 g/mol. Its IUPAC name is O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride.
Molecular Properties
| Compound Name | O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride |
| PubChem CID | 164664890 |
| Molecular Formula | C8H10Cl2N2OS |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride |
| SMILES | Cl.NNC(=S)OCc1ccccc1Cl |
| InChI | InChI=1S/C8H9ClN2OS.ClH/c9-7-4-2-1-3-6(7)5-12-8(13)11-10;/h1-4H,5,10H2,(H,11,13);1H |
| InChIKey | NJPNXQIDGRCKCU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride?
The IUPAC name of O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride (CID 164664890) is O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride.
What is the SMILES notation for O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride?
The canonical SMILES for O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride is Cl.NNC(=S)OCc1ccccc1Cl.
What is the InChIKey of O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride?
The InChIKey is NJPNXQIDGRCKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2OS.ClH/c9-7-4-2-1-3-6(7)5-12-8(13)11-10;/h1-4H,5,10H2,(H,11,13);1H.
What are the key properties of O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride?
O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride has a molecular weight of 253.15 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(2-chlorophenyl)methyl] N-aminocarbamothioate;hydrochloride is sourced from PubChem (CID 164664890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).