C25H29FN3O+ — CID 164665499
(5R)-5-tert-butyl-2-(11-fluoro-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium (PubChem CID 164665499) has the molecular formula C25H29FN3O+ and a molecular weight of 406.53 g/mol. Its IUPAC name is (5R)-5-tert-butyl-2-(11-fluoro-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium.
| Compound Name | (5R)-5-tert-butyl-2-(11-fluoro-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 164665499 |
| Molecular Formula | C25H29FN3O+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (5R)-5-tert-butyl-2-(11-fluoro-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
| SMILES | CC(C)(C)[C@@H]1COCc2nn(-c3cc4ccc3CCc3ccc(c(F)c3)CC4)c[n+]21 |
| InChI | InChI=1S/C25H29FN3O/c1-25(2,3)23-14-30-15-24-27-29(16-28(23)24)22-13-18-5-9-19-8-4-17(12-21(19)26)6-10-20(22)11-7-18/h4,7-8,11-13,16,23H,5-6,9-10,14-15H2,1-3H3/q+1/t23-/m0/s1 |
| InChIKey | JOXKNFMUNHXOBF-QHCPKHFHSA-N |
| XLogP | 4.30 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|