C26H28O2Si — CID 164665530
[3-(2-methoxy-5-methylphenyl)-1,1-diphenylprop-2-ynoxy]-trimethylsilane (PubChem CID 164665530) has the molecular formula C26H28O2Si and a molecular weight of 400.59 g/mol. Its IUPAC name is [3-(2-methoxy-5-methylphenyl)-1,1-diphenylprop-2-ynoxy]-trimethylsilane.
| Compound Name | [3-(2-methoxy-5-methylphenyl)-1,1-diphenylprop-2-ynoxy]-trimethylsilane |
|---|---|
| PubChem CID | 164665530 |
| Molecular Formula | C26H28O2Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [3-(2-methoxy-5-methylphenyl)-1,1-diphenylprop-2-ynoxy]-trimethylsilane |
| SMILES | COc1ccc(C)cc1C#CC(O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28O2Si/c1-21-16-17-25(27-2)22(20-21)18-19-26(28-29(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-17,20H,1-5H3 |
| InChIKey | MHWKCROTVIOIBS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|