About CID 164665653
CID 164665653 (PubChem CID 164665653) has the molecular formula C14H16BrO2S
and a molecular weight of 328.25 g/mol.
Molecular Properties
| Compound Name | CID 164665653 |
| PubChem CID | 164665653 |
| Molecular Formula | C14H16BrO2S |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | — |
| SMILES | O=S(=O)(/C(Br)=[C]/c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C14H16BrO2S/c15-14(11-12-7-3-1-4-8-12)18(16,17)13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-10H2 |
| InChIKey | MCXCAFMOYINWHC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 164665653 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164665653?
The IUPAC name of CID 164665653 (CID 164665653) is not available.
What is the SMILES notation for CID 164665653?
The canonical SMILES for CID 164665653 is O=S(=O)(/C(Br)=[C]/c1ccccc1)C1CCCCC1.
What is the InChIKey of CID 164665653?
The InChIKey is MCXCAFMOYINWHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrO2S/c15-14(11-12-7-3-1-4-8-12)18(16,17)13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-10H2.
What are the key properties of CID 164665653?
CID 164665653 has a molecular weight of 328.25 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164665653 is sourced from PubChem (CID 164665653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).