C20H34 — CID 164665814
(1S,3R,5S,8R,9R,11R,14R)-4,8,11-trimethyl-14-propan-2-yltetracyclo[9.3.0.01,3.05,9]tetradecane (PubChem CID 164665814) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is (1S,3R,5S,8R,9R,11R,14R)-4,8,11-trimethyl-14-propan-2-yltetracyclo[9.3.0.01,3.05,9]tetradecane.
| Compound Name | (1S,3R,5S,8R,9R,11R,14R)-4,8,11-trimethyl-14-propan-2-yltetracyclo[9.3.0.01,3.05,9]tetradecane |
|---|---|
| PubChem CID | 164665814 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | (1S,3R,5S,8R,9R,11R,14R)-4,8,11-trimethyl-14-propan-2-yltetracyclo[9.3.0.01,3.05,9]tetradecane |
| SMILES | CC(C)[C@H]1CC[C@]2(C)C[C@@H]3[C@H](C)CC[C@H]3C(C)[C@H]3C[C@]132 |
| InChI | InChI=1S/C20H34/c1-12(2)17-8-9-19(5)10-16-13(3)6-7-15(16)14(4)18-11-20(17,18)19/h12-18H,6-11H2,1-5H3/t13-,14?,15+,16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | UELOXTFDDDOCBE-GNAZFFPYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |