C50H74O8Si3 — CID 164665839
methyl (2S,3S,4S,5R,6R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4,6-bis(phenylmethoxy)heptanoate (PubChem CID 164665839) has the molecular formula C50H74O8Si3 and a molecular weight of 887.39 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4,6-bis(phenylmethoxy)heptanoate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4,6-bis(phenylmethoxy)heptanoate |
|---|---|
| PubChem CID | 164665839 |
| Molecular Formula | C50H74O8Si3 |
| Molecular Weight | 887.39 g/mol |
| Exact Mass | 886.47 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4,6-bis(phenylmethoxy)heptanoate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](OCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C50H74O8Si3/c1-48(2,3)59(11,12)57-44(45(55-36-39-29-21-16-22-30-39)43(51)46(47(52)53-10)58-60(13,14)49(4,5)6)42(54-35-38-27-19-15-20-28-38)37-56-61(50(7,8)9,40-31-23-17-24-32-40)41-33-25-18-26-34-41/h15-34,42-46,51H,35-37H2,1-14H3/t42-,43+,44-,45+,46+/m1/s1 |
| InChIKey | CEXNVPKZHRONEZ-GYNXGUMWSA-N |
| XLogP | 10.05 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.39 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|