C25H44O4S2Si — CID 164665848
tert-butyl-[(1R,2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)-2-phenylmethoxypropoxy]-dimethylsilane (PubChem CID 164665848) has the molecular formula C25H44O4S2Si and a molecular weight of 500.84 g/mol. Its IUPAC name is tert-butyl-[(1R,2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)-2-phenylmethoxypropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)-2-phenylmethoxypropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 164665848 |
| Molecular Formula | C25H44O4S2Si |
| Molecular Weight | 500.84 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | tert-butyl-[(1R,2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)-2-phenylmethoxypropoxy]-dimethylsilane |
| SMILES | CCSC(SCC)[C@H](OCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H44O4S2Si/c1-10-30-23(31-11-2)22(26-17-19-15-13-12-14-16-19)21(20-18-27-25(6,7)28-20)29-32(8,9)24(3,4)5/h12-16,20-23H,10-11,17-18H2,1-9H3/t20-,21+,22+/m0/s1 |
| InChIKey | OXNOZPLPIJBHBJ-BHDDXSALSA-N |
| XLogP | 6.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.84 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|