C14H19NO4 — CID 164666012
(2R)-2-(2,4,6-trimethoxyphenyl)pyrrolidine-1-carbaldehyde (PubChem CID 164666012) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2R)-2-(2,4,6-trimethoxyphenyl)pyrrolidine-1-carbaldehyde.
| Compound Name | (2R)-2-(2,4,6-trimethoxyphenyl)pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 164666012 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2R)-2-(2,4,6-trimethoxyphenyl)pyrrolidine-1-carbaldehyde |
| SMILES | COc1cc(OC)c([C@H]2CCCN2C=O)c(OC)c1 |
| InChI | InChI=1S/C14H19NO4/c1-17-10-7-12(18-2)14(13(8-10)19-3)11-5-4-6-15(11)9-16/h7-9,11H,4-6H2,1-3H3/t11-/m1/s1 |
| InChIKey | UJGXJUHSWXNVQN-LLVKDONJSA-N |
| XLogP | 2.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|