C19H21N — CID 164666156
(4aS,6R)-6-phenyl-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine (PubChem CID 164666156) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is (4aS,6R)-6-phenyl-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine.
| Compound Name | (4aS,6R)-6-phenyl-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine |
|---|---|
| PubChem CID | 164666156 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (4aS,6R)-6-phenyl-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine |
| SMILES | c1ccc([C@H]2C[C@@H]3CCCCN3c3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N/c1-2-8-15(9-3-1)18-14-16-10-6-7-13-20(16)19-12-5-4-11-17(18)19/h1-5,8-9,11-12,16,18H,6-7,10,13-14H2/t16-,18+/m0/s1 |
| InChIKey | XTWIMLUDUPRIBT-FUHWJXTLSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |