C18H16F11NO — CID 164666200
(Z)-3-(diethylamino)-4,4,5,5,6,6,7,7,8,8,8-undecafluoro-1-phenyloct-2-en-1-one (PubChem CID 164666200) has the molecular formula C18H16F11NO and a molecular weight of 471.31 g/mol. Its IUPAC name is (Z)-3-(diethylamino)-4,4,5,5,6,6,7,7,8,8,8-undecafluoro-1-phenyloct-2-en-1-one.
| Compound Name | (Z)-3-(diethylamino)-4,4,5,5,6,6,7,7,8,8,8-undecafluoro-1-phenyloct-2-en-1-one |
|---|---|
| PubChem CID | 164666200 |
| Molecular Formula | C18H16F11NO |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (Z)-3-(diethylamino)-4,4,5,5,6,6,7,7,8,8,8-undecafluoro-1-phenyloct-2-en-1-one |
| SMILES | CCN(CC)/C(=C\C(=O)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H16F11NO/c1-3-30(4-2)13(10-12(31)11-8-6-5-7-9-11)14(19,20)15(21,22)16(23,24)17(25,26)18(27,28)29/h5-10H,3-4H2,1-2H3/b13-10- |
| InChIKey | WZRJJASDYOHHNS-RAXLEYEMSA-N |
| XLogP | 6.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|