C30H30O8 — CID 164666348
(2R,3S,4S,9S,13S,18R,19S)-2-hydroxy-7,16-dimethoxy-6,15,19-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]hexacyclo[10.7.1.03,18.04,9.09,13.013,18]icosa-6,12(20),15-triene-5,8,11,14,17-pentone (PubChem CID 164666348) has the molecular formula C30H30O8 and a molecular weight of 518.56 g/mol. Its IUPAC name is (2R,3S,4S,9S,13S,18R,19S)-2-hydroxy-7,16-dimethoxy-6,15,19-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]hexacyclo[10.7.1.03,18.04,9.09,13.013,18]icosa-6,12(20),15-triene-5,8,11,14,17-pentone.
| Compound Name | (2R,3S,4S,9S,13S,18R,19S)-2-hydroxy-7,16-dimethoxy-6,15,19-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]hexacyclo[10.7.1.03,18.04,9.09,13.013,18]icosa-6,12(20),15-triene-5,8,11,14,17-pentone |
|---|---|
| PubChem CID | 164666348 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (2R,3S,4S,9S,13S,18R,19S)-2-hydroxy-7,16-dimethoxy-6,15,19-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]hexacyclo[10.7.1.03,18.04,9.09,13.013,18]icosa-6,12(20),15-triene-5,8,11,14,17-pentone |
| SMILES | C/C=C/C=C/[C@@]1(O)C2C=C3C(=O)C[C@]45C(=O)C(OC)=C(C)C(=O)[C@H]4[C@H]1[C@]1(C(=O)C(OC)=C(C)C(=O)[C@]315)[C@H]2C |
| InChI | InChI=1S/C30H30O8/c1-7-8-9-10-28(36)16-11-17-18(31)12-27-19(20(32)13(2)21(37-5)25(27)34)23(28)29(15(16)4)26(35)22(38-6)14(3)24(33)30(17,27)29/h7-11,15-16,19,23,36H,12H2,1-6H3/b8-7+,10-9+/t15-,16?,19-,23+,27+,28+,29-,30-/m0/s1 |
| InChIKey | AKJZXFUZNHDJLF-UJPABMSWSA-N |
| XLogP | 2.38 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|