About tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate
tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate (PubChem CID 164666503) has the molecular formula C29H35INO3P
and a molecular weight of 603.48 g/mol. Its IUPAC name is tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate |
| PubChem CID | 164666503 |
| Molecular Formula | C29H35INO3P |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COP(I)(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H35INO3P/c1-29(2,3)34-28(32)31-21-19-24(20-22-31)23-33-35(30,25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-18,24H,19-23H2,1-3H3 |
| InChIKey | YIHZFOGSSZPGCH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate (CID 164666503) is tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(COP(I)(c2ccccc2)(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate?
The InChIKey is YIHZFOGSSZPGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H35INO3P/c1-29(2,3)34-28(32)31-21-19-24(20-22-31)23-33-35(30,25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-18,24H,19-23H2,1-3H3.
What are the key properties of tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate?
tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate has a molecular weight of 603.48 g/mol, XLogP of 6.44, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[iodo(triphenyl)-λ5-phosphanyl]oxymethyl]piperidine-1-carboxylate is sourced from PubChem (CID 164666503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).