C11H16O2 — CID 164666540
(4S,5R)-4,5-bis(prop-2-enyl)oxan-2-one (PubChem CID 164666540) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (4S,5R)-4,5-bis(prop-2-enyl)oxan-2-one.
| Compound Name | (4S,5R)-4,5-bis(prop-2-enyl)oxan-2-one |
|---|---|
| PubChem CID | 164666540 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (4S,5R)-4,5-bis(prop-2-enyl)oxan-2-one |
| SMILES | C=CC[C@H]1COC(=O)C[C@@H]1CC=C |
| InChI | InChI=1S/C11H16O2/c1-3-5-9-7-11(12)13-8-10(9)6-4-2/h3-4,9-10H,1-2,5-8H2/t9-,10-/m0/s1 |
| InChIKey | LLVARHBBXUYPFY-UWVGGRQHSA-N |
| XLogP | 2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|