About 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene
1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene (PubChem CID 164666559) has the molecular formula C13H16BrF3O3S
and a molecular weight of 389.23 g/mol. Its IUPAC name is 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene.
Molecular Properties
| Compound Name | 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene |
| PubChem CID | 164666559 |
| Molecular Formula | C13H16BrF3O3S |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1ccc(C(OCCCCBr)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16BrF3O3S/c1-21(18,19)11-6-4-10(5-7-11)12(13(15,16)17)20-9-3-2-8-14/h4-7,12H,2-3,8-9H2,1H3 |
| InChIKey | JIJJBXPHGBUKAG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene?
The IUPAC name of 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene (CID 164666559) is 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene.
What is the SMILES notation for 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene?
The canonical SMILES for 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene is CS(=O)(=O)c1ccc(C(OCCCCBr)C(F)(F)F)cc1.
What is the InChIKey of 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene?
The InChIKey is JIJJBXPHGBUKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrF3O3S/c1-21(18,19)11-6-4-10(5-7-11)12(13(15,16)17)20-9-3-2-8-14/h4-7,12H,2-3,8-9H2,1H3.
What are the key properties of 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene?
1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene has a molecular weight of 389.23 g/mol, XLogP of 3.89, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-bromobutoxy)-2,2,2-trifluoroethyl]-4-methylsulfonylbenzene is sourced from PubChem (CID 164666559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).