C30H34O9 — CID 164666645
2-[(9S,12R,15R)-12-[(E)-hept-5-enyl]-15-[(E)-hex-4-enoyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetic acid (PubChem CID 164666645) has the molecular formula C30H34O9 and a molecular weight of 538.59 g/mol. Its IUPAC name is 2-[(9S,12R,15R)-12-[(E)-hept-5-enyl]-15-[(E)-hex-4-enoyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetic acid.
| Compound Name | 2-[(9S,12R,15R)-12-[(E)-hept-5-enyl]-15-[(E)-hex-4-enoyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetic acid |
|---|---|
| PubChem CID | 164666645 |
| Molecular Formula | C30H34O9 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[(9S,12R,15R)-12-[(E)-hept-5-enyl]-15-[(E)-hex-4-enoyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetic acid |
| SMILES | C/C=C/CCCC[C@H]1C=C2C34OC(=O)[C@]2(CC(=O)O)CC2=C(C(=O)OC2=O)C3C1C[C@H](C(=O)CC/C=C/C)O4 |
| InChI | InChI=1S/C30H34O9/c1-3-5-7-8-10-11-17-13-22-29(16-23(32)33)15-19-24(27(35)37-26(19)34)25-18(17)14-21(20(31)12-9-6-4-2)38-30(22,25)39-28(29)36/h3-6,13,17-18,21,25H,7-12,14-16H2,1-2H3,(H,32,33)/b5-3+,6-4+/t17-,18?,21+,25?,29-,30?/m0/s1 |
| InChIKey | AVLWWKPUBFFSOI-PRPRCPQUSA-N |
| XLogP | 4.12 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|