C16H21FOS3 — CID 164666712
2-(4-fluoropentylsulfanyl)-3,3-bis(methylsulfanyl)-1-phenylprop-2-en-1-one (PubChem CID 164666712) has the molecular formula C16H21FOS3 and a molecular weight of 344.54 g/mol. Its IUPAC name is 2-(4-fluoropentylsulfanyl)-3,3-bis(methylsulfanyl)-1-phenylprop-2-en-1-one.
| Compound Name | 2-(4-fluoropentylsulfanyl)-3,3-bis(methylsulfanyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 164666712 |
| Molecular Formula | C16H21FOS3 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-(4-fluoropentylsulfanyl)-3,3-bis(methylsulfanyl)-1-phenylprop-2-en-1-one |
| SMILES | CSC(SC)=C(SCCCC(C)F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21FOS3/c1-12(17)8-7-11-21-15(16(19-2)20-3)14(18)13-9-5-4-6-10-13/h4-6,9-10,12H,7-8,11H2,1-3H3 |
| InChIKey | FUGRBGCZIBSZLA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|