About (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate
(1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate (PubChem CID 164666722) has the molecular formula C7H12O2S
and a molecular weight of 160.24 g/mol. Its IUPAC name is (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate.
Molecular Properties
| Compound Name | (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate |
| PubChem CID | 164666722 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate |
| SMILES | CO/C([O-])=C/C=C/[S+](C)C |
| InChI | InChI=1S/C7H12O2S/c1-9-7(8)5-4-6-10(2)3/h4-6H,1-3H3/b6-4+,7-5+ |
| InChIKey | SYJIAOOAJKIWNZ-YDFGWWAZSA-N |
| XLogP | 0.23 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate?
The IUPAC name of (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate (CID 164666722) is (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate.
What is the SMILES notation for (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate?
The canonical SMILES for (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate is CO/C([O-])=C/C=C/[S+](C)C.
What is the InChIKey of (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate?
The InChIKey is SYJIAOOAJKIWNZ-YDFGWWAZSA-N. The full InChI is InChI=1S/C7H12O2S/c1-9-7(8)5-4-6-10(2)3/h4-6H,1-3H3/b6-4+,7-5+.
What are the key properties of (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate?
(1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate has a molecular weight of 160.24 g/mol, XLogP of 0.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-4-dimethylsulfonio-1-methoxybuta-1,3-dien-1-olate is sourced from PubChem (CID 164666722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).