C19H27NO5 — CID 164666988
ditert-butyl (1S,7R,8R)-11-oxa-3-azatricyclo[6.2.1.01,6]undeca-5,9-diene-3,7-dicarboxylate (PubChem CID 164666988) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is ditert-butyl (1S,7R,8R)-11-oxa-3-azatricyclo[6.2.1.01,6]undeca-5,9-diene-3,7-dicarboxylate.
| Compound Name | ditert-butyl (1S,7R,8R)-11-oxa-3-azatricyclo[6.2.1.01,6]undeca-5,9-diene-3,7-dicarboxylate |
|---|---|
| PubChem CID | 164666988 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | ditert-butyl (1S,7R,8R)-11-oxa-3-azatricyclo[6.2.1.01,6]undeca-5,9-diene-3,7-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C2=CCN(C(=O)OC(C)(C)C)C[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C19H27NO5/c1-17(2,3)24-15(21)14-12-8-10-20(16(22)25-18(4,5)6)11-19(12)9-7-13(14)23-19/h7-9,13-14H,10-11H2,1-6H3/t13-,14-,19-/m1/s1 |
| InChIKey | IAQQHRPNBPNENA-PJIJBLCYSA-N |
| XLogP | 2.83 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|