About 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene
3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene (PubChem CID 164666998) has the molecular formula C17H16O3S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene |
| PubChem CID | 164666998 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene |
| SMILES | COc1ccc(S(=O)(=O)C2=Cc3ccccc3CC2)cc1 |
| InChI | InChI=1S/C17H16O3S/c1-20-15-7-10-16(11-8-15)21(18,19)17-9-6-13-4-2-3-5-14(13)12-17/h2-5,7-8,10-12H,6,9H2,1H3 |
| InChIKey | KDUKYRCQJFJCGM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene?
The IUPAC name of 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene (CID 164666998) is 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene.
What is the SMILES notation for 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene?
The canonical SMILES for 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene is COc1ccc(S(=O)(=O)C2=Cc3ccccc3CC2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene?
The InChIKey is KDUKYRCQJFJCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3S/c1-20-15-7-10-16(11-8-15)21(18,19)17-9-6-13-4-2-3-5-14(13)12-17/h2-5,7-8,10-12H,6,9H2,1H3.
What are the key properties of 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene?
3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene has a molecular weight of 300.38 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)sulfonyl-1,2-dihydronaphthalene is sourced from PubChem (CID 164666998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).