About 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione
4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione (PubChem CID 164667125) has the molecular formula C21H14O3S
and a molecular weight of 346.41 g/mol. Its IUPAC name is 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione.
Molecular Properties
| Compound Name | 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| PubChem CID | 164667125 |
| Molecular Formula | C21H14O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| SMILES | O=C1C=CC2(C=C1)OC(=O)C(Sc1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C21H14O3S/c22-16-11-13-21(14-12-16)18(15-7-3-1-4-8-15)19(20(23)24-21)25-17-9-5-2-6-10-17/h1-14H |
| InChIKey | SCTBLDCXVZYZPU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione?
The IUPAC name of 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione (CID 164667125) is 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione.
What is the SMILES notation for 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione?
The canonical SMILES for 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione is O=C1C=CC2(C=C1)OC(=O)C(Sc1ccccc1)=C2c1ccccc1.
What is the InChIKey of 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione?
The InChIKey is SCTBLDCXVZYZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14O3S/c22-16-11-13-21(14-12-16)18(15-7-3-1-4-8-15)19(20(23)24-21)25-17-9-5-2-6-10-17/h1-14H.
What are the key properties of 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione?
4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione has a molecular weight of 346.41 g/mol, XLogP of 4.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione is sourced from PubChem (CID 164667125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).