C20H15F17OS — CID 164667149
2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-4-methoxy-1-prop-2-enylbenzene (PubChem CID 164667149) has the molecular formula C20H15F17OS and a molecular weight of 626.37 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-4-methoxy-1-prop-2-enylbenzene.
| Compound Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-4-methoxy-1-prop-2-enylbenzene |
|---|---|
| PubChem CID | 164667149 |
| Molecular Formula | C20H15F17OS |
| Molecular Weight | 626.37 g/mol |
| Exact Mass | 626.06 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-4-methoxy-1-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(OC)cc1SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H15F17OS/c1-3-4-10-5-6-11(38-2)9-12(10)39-8-7-13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h3,5-6,9H,1,4,7-8H2,2H3 |
| InChIKey | PSMGDDRRVAQPSI-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.37 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|