C16H28O4Si — CID 164667415
(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-5-methylidene-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-one (PubChem CID 164667415) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-5-methylidene-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-5-methylidene-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 164667415 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-5-methylidene-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-one |
| SMILES | C=C1C(=O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O4Si/c1-10-11(9-18-21(7,8)15(2,3)4)13-14(12(10)17)20-16(5,6)19-13/h11,13-14H,1,9H2,2-8H3/t11-,13+,14-/m0/s1 |
| InChIKey | MCUXNLMGEIFGQE-YUTCNCBUSA-N |
| XLogP | 3.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|